C17H33N7 — CID 111248747
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-prop-2-enylguanidine (PubChem CID 111248747) has the molecular formula C17H33N7 and a molecular weight of 335.50 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-prop-2-enylguanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111248747 |
| Molecular Formula | C17H33N7 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-[di(propan-2-yl)amino]ethyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C17H33N7/c1-8-9-18-17(19-10-11-24(13(2)3)14(4)5)20-12-16-22-21-15(6)23(16)7/h8,13-14H,1,9-12H2,2-7H3,(H2,18,19,20) |
| InChIKey | FLPXTPFBJQMSRS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|