C17H32IN7O2 — CID 111886020
tert-butyl N-[3-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111886020) has the molecular formula C17H32IN7O2 and a molecular weight of 493.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886020 |
| Molecular Formula | C17H32IN7O2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | tert-butyl N-[3-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C17H31N7O2.HI/c1-7-9-18-15(21-12-14-23-22-13(2)24(14)6)19-10-8-11-20-16(25)26-17(3,4)5;/h7H,1,8-12H2,2-6H3,(H,20,25)(H2,18,19,21);1H |
| InChIKey | CSMPXSPWBFCUAC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|