C12H23IN6S — CID 111343902
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methylsulfanylethyl)-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111343902) has the molecular formula C12H23IN6S and a molecular weight of 410.33 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methylsulfanylethyl)-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methylsulfanylethyl)-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111343902 |
| Molecular Formula | C12H23IN6S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methylsulfanylethyl)-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NCCSC.I |
| InChI | InChI=1S/C12H22N6S.HI/c1-5-6-13-12(14-7-8-19-4)15-9-11-17-16-10(2)18(11)3;/h5H,1,6-9H2,2-4H3,(H2,13,14,15);1H |
| InChIKey | BXRFMWVEZNTEMI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|