C16H25BrN4 — CID 111922261
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-propylguanidine (PubChem CID 111922261) has the molecular formula C16H25BrN4 and a molecular weight of 353.31 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-propylguanidine.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-propylguanidine |
|---|---|
| PubChem CID | 111922261 |
| Molecular Formula | C16H25BrN4 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-propylguanidine |
| SMILES | CCC/N=C(\NCC)NC1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C16H25BrN4/c1-3-10-19-16(18-4-2)20-13-9-11-21(12-13)15-8-6-5-7-14(15)17/h5-8,13H,3-4,9-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | GJOOWPDGJKZDHJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|