C19H29BrN4O — CID 111994831
1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(1-hydroxycyclopentyl)methyl]guanidine (PubChem CID 111994831) has the molecular formula C19H29BrN4O and a molecular weight of 409.37 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(1-hydroxycyclopentyl)methyl]guanidine.
| Compound Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(1-hydroxycyclopentyl)methyl]guanidine |
|---|---|
| PubChem CID | 111994831 |
| Molecular Formula | C19H29BrN4O |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[1-(2-bromophenyl)pyrrolidin-3-yl]-3-ethyl-2-[(1-hydroxycyclopentyl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(O)CCCC1)NC1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C19H29BrN4O/c1-2-21-18(22-14-19(25)10-5-6-11-19)23-15-9-12-24(13-15)17-8-4-3-7-16(17)20/h3-4,7-8,15,25H,2,5-6,9-14H2,1H3,(H2,21,22,23) |
| InChIKey | OGGYMVGFOIMUNU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|