C20H27BrIN5O2 — CID 111922620
N-[2-[[[[1-(2-bromophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111922620) has the molecular formula C20H27BrIN5O2 and a molecular weight of 576.28 g/mol. Its IUPAC name is N-[2-[[[[1-(2-bromophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[[[1-(2-bromophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111922620 |
| Molecular Formula | C20H27BrIN5O2 |
| Molecular Weight | 576.28 g/mol |
| Exact Mass | 575.04 |
| IUPAC Name | N-[2-[[[[1-(2-bromophenyl)pyrrolidin-3-yl]amino]-(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccco1)NC1CCN(c2ccccc2Br)C1.I |
| InChI | InChI=1S/C20H26BrN5O2.HI/c1-2-22-20(24-11-10-23-19(27)18-8-5-13-28-18)25-15-9-12-26(14-15)17-7-4-3-6-16(17)21;/h3-8,13,15H,2,9-12,14H2,1H3,(H,23,27)(H2,22,24,25);1H |
| InChIKey | FIJTVJCHHIVVHL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|