C22H36N4O — CID 111994159
1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[1-(1-phenylethyl)piperidin-4-yl]guanidine (PubChem CID 111994159) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[1-(1-phenylethyl)piperidin-4-yl]guanidine.
| Compound Name | 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[1-(1-phenylethyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 111994159 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[1-(1-phenylethyl)piperidin-4-yl]guanidine |
| SMILES | CCN/C(=N\CC1(O)CCCC1)NC1CCN(C(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H36N4O/c1-3-23-21(24-17-22(27)13-7-8-14-22)25-20-11-15-26(16-12-20)18(2)19-9-5-4-6-10-19/h4-6,9-10,18,20,27H,3,7-8,11-17H2,1-2H3,(H2,23,24,25) |
| InChIKey | AETAHYYVINTWEZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|