C24H34ClIN4O — CID 111994176
2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(1-phenylethyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 111994176) has the molecular formula C24H34ClIN4O and a molecular weight of 556.92 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(1-phenylethyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(1-phenylethyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111994176 |
| Molecular Formula | C24H34ClIN4O |
| Molecular Weight | 556.92 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[1-(1-phenylethyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)NC1CCN(C(C)c2ccccc2)CC1.I |
| InChI | InChI=1S/C24H33ClN4O.HI/c1-3-26-24(27-17-23(30)21-11-7-8-12-22(21)25)28-20-13-15-29(16-14-20)18(2)19-9-5-4-6-10-19;/h4-12,18,20,23,30H,3,13-17H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | QMIRXXMRYRJLAE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|