C20H31ClN4O — CID 111993943
2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-(1-cyclopentylpyrrolidin-3-yl)-3-ethylguanidine (PubChem CID 111993943) has the molecular formula C20H31ClN4O and a molecular weight of 378.95 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-(1-cyclopentylpyrrolidin-3-yl)-3-ethylguanidine.
| Compound Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-(1-cyclopentylpyrrolidin-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111993943 |
| Molecular Formula | C20H31ClN4O |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-(1-cyclopentylpyrrolidin-3-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C20H31ClN4O/c1-2-22-20(23-13-19(26)17-9-5-6-10-18(17)21)24-15-11-12-25(14-15)16-7-3-4-8-16/h5-6,9-10,15-16,19,26H,2-4,7-8,11-14H2,1H3,(H2,22,23,24) |
| InChIKey | DWCLNMVVBAGMSG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|