C20H32FIN4O — CID 111993818
1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide (PubChem CID 111993818) has the molecular formula C20H32FIN4O and a molecular weight of 490.41 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111993818 |
| Molecular Formula | C20H32FIN4O |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[2-(2-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1F)NC1CCN(C2CCCC2)C1.I |
| InChI | InChI=1S/C20H31FN4O.HI/c1-2-22-20(23-13-19(26)17-9-5-6-10-18(17)21)24-15-11-12-25(14-15)16-7-3-4-8-16;/h5-6,9-10,15-16,19,26H,2-4,7-8,11-14H2,1H3,(H2,22,23,24);1H |
| InChIKey | HPVYPQFXAUEWQK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|