C19H30BrN5O — CID 110041328
2-[[[[1-(2-bromophenyl)pyrrolidin-3-yl]amino]-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110041328) has the molecular formula C19H30BrN5O and a molecular weight of 424.39 g/mol. Its IUPAC name is 2-[[[[1-(2-bromophenyl)pyrrolidin-3-yl]amino]-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[1-(2-bromophenyl)pyrrolidin-3-yl]amino]-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110041328 |
| Molecular Formula | C19H30BrN5O |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[[[[1-(2-bromophenyl)pyrrolidin-3-yl]amino]-(2-methylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC(C)CN/C(=N\CC(=O)N(C)C)NC1CCN(c2ccccc2Br)C1 |
| InChI | InChI=1S/C19H30BrN5O/c1-14(2)11-21-19(22-12-18(26)24(3)4)23-15-9-10-25(13-15)17-8-6-5-7-16(17)20/h5-8,14-15H,9-13H2,1-4H3,(H2,21,22,23) |
| InChIKey | IHYGMXLAAOYXSE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|