C20H35IN8O2 — CID 111378489
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111378489) has the molecular formula C20H35IN8O2 and a molecular weight of 546.46 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111378489 |
| Molecular Formula | C20H35IN8O2 |
| Molecular Weight | 546.46 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)N1CCN(Cc2cc(C)on2)CC1.I |
| InChI | InChI=1S/C20H34N8O2.HI/c1-5-29-12-6-7-21-20(22-14-19-24-23-17(3)26(19)4)28-10-8-27(9-11-28)15-18-13-16(2)30-25-18;/h13H,5-12,14-15H2,1-4H3,(H,21,22);1H |
| InChIKey | RGULQZOBKVIYRA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|