C20H37N7O3 — CID 111729763
tert-butyl N-[1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729763) has the molecular formula C20H37N7O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729763 |
| Molecular Formula | C20H37N7O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | tert-butyl N-[1-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H37N7O3/c1-7-29-12-8-10-21-18(22-13-17-25-24-15(2)26(17)6)27-11-9-16(14-27)23-19(28)30-20(3,4)5/h16H,7-14H2,1-6H3,(H,21,22)(H,23,28) |
| InChIKey | JRXVJALFEABQRH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|