C19H36IN7O3 — CID 111328209
ethyl 4-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328209) has the molecular formula C19H36IN7O3 and a molecular weight of 537.45 g/mol. Its IUPAC name is ethyl 4-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328209 |
| Molecular Formula | C19H36IN7O3 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | ethyl 4-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-ethoxypropyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C19H35N7O3.HI/c1-5-28-13-7-10-20-18(21-14-17-24-23-15(3)25(17)4)22-16-8-11-26(12-9-16)19(27)29-6-2;/h16H,5-14H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | INYRIKZJQWSITH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|