C21H31N7O2 — CID 111913746
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-(5-oxo-1-phenylpyrrolidin-3-yl)guanidine (PubChem CID 111913746) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-(5-oxo-1-phenylpyrrolidin-3-yl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-(5-oxo-1-phenylpyrrolidin-3-yl)guanidine |
|---|---|
| PubChem CID | 111913746 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-(5-oxo-1-phenylpyrrolidin-3-yl)guanidine |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NC1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C21H31N7O2/c1-4-30-12-8-11-22-21(23-14-19-26-25-16(2)27(19)3)24-17-13-20(29)28(15-17)18-9-6-5-7-10-18/h5-7,9-10,17H,4,8,11-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | RBXLAOFRAJSSKZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|