C16H23N3O3 — CID 7513345
1-(3-ethoxypropyl)-3-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]urea (PubChem CID 7513345) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]urea.
| Compound Name | 1-(3-ethoxypropyl)-3-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 7513345 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[(3R)-5-oxo-1-phenylpyrrolidin-3-yl]urea |
| SMILES | CCOCCCNC(=O)N[C@@H]1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C16H23N3O3/c1-2-22-10-6-9-17-16(21)18-13-11-15(20)19(12-13)14-7-4-3-5-8-14/h3-5,7-8,13H,2,6,9-12H2,1H3,(H2,17,18,21)/t13-/m1/s1 |
| InChIKey | DKWTVLVPDYVBNC-CYBMUJFWSA-N |
| XLogP | 1.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|