C20H28ClN7 — CID 111357418
4-[(3-chlorophenyl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide (PubChem CID 111357418) has the molecular formula C20H28ClN7 and a molecular weight of 401.95 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide.
| Compound Name | 4-[(3-chlorophenyl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111357418 |
| Molecular Formula | C20H28ClN7 |
| Molecular Weight | 401.95 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H28ClN7/c1-4-8-22-20(23-14-19-25-24-16(2)26(19)3)28-11-9-27(10-12-28)15-17-6-5-7-18(21)13-17/h4-7,13H,1,8-12,14-15H2,2-3H3,(H,22,23) |
| InChIKey | GFAYOIKTCFHVLD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.95 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|