C17H23ClN6 — CID 111319674
1-[1-(3-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine (PubChem CID 111319674) has the molecular formula C17H23ClN6 and a molecular weight of 346.87 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111319674 |
| Molecular Formula | C17H23ClN6 |
| Molecular Weight | 346.87 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NC(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H23ClN6/c1-5-9-19-17(20-11-16-23-22-13(3)24(16)4)21-12(2)14-7-6-8-15(18)10-14/h5-8,10,12H,1,9,11H2,2-4H3,(H2,19,20,21) |
| InChIKey | CNJFCKMPOBQKHB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|