C21H34IN7 — CID 111347571
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-[(4-propan-2-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111347571) has the molecular formula C21H34IN7 and a molecular weight of 511.46 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-[(4-propan-2-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-[(4-propan-2-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111347571 |
| Molecular Formula | C21H34IN7 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-[(4-propan-2-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)N1CCN(Cc2ccc(C(C)C)cc2)CC1.I |
| InChI | InChI=1S/C21H33N7.HI/c1-16(2)19-8-6-18(7-9-19)15-27-10-12-28(13-11-27)21(22-4)23-14-20-25-24-17(3)26(20)5;/h6-9,16H,10-15H2,1-5H3,(H,22,23);1H |
| InChIKey | OPFBKYNEJLFAPN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|