C15H27IN6O2 — CID 111156840
ethyl 1-[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156840) has the molecular formula C15H27IN6O2 and a molecular weight of 450.33 g/mol. Its IUPAC name is ethyl 1-[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156840 |
| Molecular Formula | C15H27IN6O2 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | ethyl 1-[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/C)NCc2nnc(C)n2C)CC1.I |
| InChI | InChI=1S/C15H26N6O2.HI/c1-5-23-14(22)12-6-8-21(9-7-12)15(16-3)17-10-13-19-18-11(2)20(13)4;/h12H,5-10H2,1-4H3,(H,16,17);1H |
| InChIKey | YMYMHNNGBQCOOL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|