C20H28N6 — CID 111724177
N-ethyl-3-phenyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111724177) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is N-ethyl-3-phenyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-phenyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724177 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-ethyl-3-phenyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C20H28N6/c1-2-21-20(22-14-19-24-23-18-10-6-7-12-26(18)19)25-13-11-17(15-25)16-8-4-3-5-9-16/h3-5,8-9,17H,2,6-7,10-15H2,1H3,(H,21,22) |
| InChIKey | YXNCLRINIOCEHJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|