C22H32N6S — CID 111748640
N'-methyl-3-(phenylsulfanylmethyl)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111748640) has the molecular formula C22H32N6S and a molecular weight of 412.61 g/mol. Its IUPAC name is N'-methyl-3-(phenylsulfanylmethyl)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(phenylsulfanylmethyl)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748640 |
| Molecular Formula | C22H32N6S |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | N'-methyl-3-(phenylsulfanylmethyl)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1nnc2n1CCCCC2)N1CCC(CSc2ccccc2)C1 |
| InChI | InChI=1S/C22H32N6S/c1-23-22(24-13-11-21-26-25-20-10-6-3-7-14-28(20)21)27-15-12-18(16-27)17-29-19-8-4-2-5-9-19/h2,4-5,8-9,18H,3,6-7,10-17H2,1H3,(H,23,24) |
| InChIKey | JNLUOIIDDVUMIQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|