C17H24N6O4S2 — CID 109423246
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 109423246) has the molecular formula C17H24N6O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 109423246 |
| Molecular Formula | C17H24N6O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H24N6O4S2/c1-4-18-17(22(3)11-14-12-28-13(2)21-14)19-8-9-20-29(26,27)16-7-5-6-15(10-16)23(24)25/h5-7,10,12,20H,4,8-9,11H2,1-3H3,(H,18,19) |
| InChIKey | WKGICCILQYXVOR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|