C20H28IN5O5S — CID 111281362
3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111281362) has the molecular formula C20H28IN5O5S and a molecular weight of 577.45 g/mol. Its IUPAC name is 3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111281362 |
| Molecular Formula | C20H28IN5O5S |
| Molecular Weight | 577.45 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methyl-2-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C20H27N5O5S.HI/c1-4-21-20(24(2)15-16-8-5-6-11-19(16)30-3)22-12-13-23-31(28,29)18-10-7-9-17(14-18)25(26)27;/h5-11,14,23H,4,12-13,15H2,1-3H3,(H,21,22);1H |
| InChIKey | MUJDHFSNEPDADP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|