C18H23IN4O3 — CID 111282110
1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111282110) has the molecular formula C18H23IN4O3 and a molecular weight of 470.31 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111282110 |
| Molecular Formula | C18H23IN4O3 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc([N+](=O)[O-])c1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C18H22N4O3.HI/c1-19-18(20-12-14-7-6-9-16(11-14)22(23)24)21(2)13-15-8-4-5-10-17(15)25-3;/h4-11H,12-13H2,1-3H3,(H,19,20);1H |
| InChIKey | URHALCMQOKHDEA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|