C18H23IN4O2 — CID 111287208
1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111287208) has the molecular formula C18H23IN4O2 and a molecular weight of 454.31 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111287208 |
| Molecular Formula | C18H23IN4O2 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc([N+](=O)[O-])c1)N(C)Cc1ccccc1C.I |
| InChI | InChI=1S/C18H22N4O2.HI/c1-14-7-4-5-9-16(14)13-21(3)18(19-2)20-12-15-8-6-10-17(11-15)22(23)24;/h4-11H,12-13H2,1-3H3,(H,19,20);1H |
| InChIKey | VOVOMFMAVCJRCE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|