C15H18ClIN4O2S — CID 111363222
1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111363222) has the molecular formula C15H18ClIN4O2S and a molecular weight of 480.76 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111363222 |
| Molecular Formula | C15H18ClIN4O2S |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc([N+](=O)[O-])c1)N(C)Cc1ccc(Cl)s1.I |
| InChI | InChI=1S/C15H17ClN4O2S.HI/c1-17-15(19(2)10-13-6-7-14(16)23-13)18-9-11-4-3-5-12(8-11)20(21)22;/h3-8H,9-10H2,1-2H3,(H,17,18);1H |
| InChIKey | VPMHSGOIPNDBMY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|