C19H24IN5O3 — CID 111874990
N,N-dimethyl-4-[[[N'-methyl-N-[(3-nitrophenyl)methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111874990) has the molecular formula C19H24IN5O3 and a molecular weight of 497.34 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[(3-nitrophenyl)methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[(3-nitrophenyl)methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111874990 |
| Molecular Formula | C19H24IN5O3 |
| Molecular Weight | 497.34 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[(3-nitrophenyl)methyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C(=O)N(C)C)cc1)NCc1cccc([N+](=O)[O-])c1.I |
| InChI | InChI=1S/C19H23N5O3.HI/c1-20-19(22-13-15-5-4-6-17(11-15)24(26)27)21-12-14-7-9-16(10-8-14)18(25)23(2)3;/h4-11H,12-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | SVQLFSNTXTVUPT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|