C11H15ClF3N3S — CID 111984695
1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111984695) has the molecular formula C11H15ClF3N3S and a molecular weight of 313.78 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111984695 |
| Molecular Formula | C11H15ClF3N3S |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H15ClF3N3S/c1-16-10(17-6-5-11(13,14)15)18(2)7-8-3-4-9(12)19-8/h3-4H,5-7H2,1-2H3,(H,16,17) |
| InChIKey | FRDIKPNDZXKJHA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|