C20H35ClIN5S — CID 111497756
1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111497756) has the molecular formula C20H35ClIN5S and a molecular weight of 539.96 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111497756 |
| Molecular Formula | C20H35ClIN5S |
| Molecular Weight | 539.96 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(N2CCCCC2)CCN(C)CC1)N(C)Cc1ccc(Cl)s1.I |
| InChI | InChI=1S/C20H34ClN5S.HI/c1-22-19(25(3)15-17-7-8-18(21)27-17)23-16-20(9-13-24(2)14-10-20)26-11-5-4-6-12-26;/h7-8H,4-6,9-16H2,1-3H3,(H,22,23);1H |
| InChIKey | SZQHCZLQRCBSCX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|