C21H30IN3O4 — CID 111281474
1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111281474) has the molecular formula C21H30IN3O4 and a molecular weight of 515.39 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111281474 |
| Molecular Formula | C21H30IN3O4 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)c(OC)c1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C21H29N3O4.HI/c1-22-21(24(2)14-16-9-7-8-10-17(16)25-3)23-13-15-11-18(26-4)20(28-6)19(12-15)27-5;/h7-12H,13-14H2,1-6H3,(H,22,23);1H |
| InChIKey | DQOANIUWBXGEQZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|