C11H11N3O4S2 — CID 110717463
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-nitrobenzenesulfonamide (PubChem CID 110717463) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110717463 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1nc(CNS(=O)(=O)c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C11H11N3O4S2/c1-8-13-9(7-19-8)6-12-20(17,18)11-4-2-3-10(5-11)14(15)16/h2-5,7,12H,6H2,1H3 |
| InChIKey | XRKDKPLAXNWQCC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|