C11H12N4O4S2 — CID 115993516
3-amino-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitrobenzenesulfonamide (PubChem CID 115993516) has the molecular formula C11H12N4O4S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 3-amino-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitrobenzenesulfonamide.
| Compound Name | 3-amino-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115993516 |
| Molecular Formula | C11H12N4O4S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 3-amino-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitrobenzenesulfonamide |
| SMILES | Cc1nc(CNS(=O)(=O)c2cccc(N)c2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H12N4O4S2/c1-7-14-8(6-20-7)5-13-21(18,19)10-4-2-3-9(12)11(10)15(16)17/h2-4,6,13H,5,12H2,1H3 |
| InChIKey | LBGZFDGFGWTHSG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|