C8H9N7O4S — CID 115993512
3-amino-2-nitro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide (PubChem CID 115993512) has the molecular formula C8H9N7O4S and a molecular weight of 299.27 g/mol. Its IUPAC name is 3-amino-2-nitro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-2-nitro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115993512 |
| Molecular Formula | C8H9N7O4S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-amino-2-nitro-N-(2H-tetrazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cccc(S(=O)(=O)NCc2nn[nH]n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N7O4S/c9-5-2-1-3-6(8(5)15(16)17)20(18,19)10-4-7-11-13-14-12-7/h1-3,10H,4,9H2,(H,11,12,13,14) |
| InChIKey | ZXSJWXHNJDIKDV-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 169.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|