C16H28ClIN4OS — CID 111363232
N-[2-[[[(5-chlorothiophen-2-yl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111363232) has the molecular formula C16H28ClIN4OS and a molecular weight of 486.85 g/mol. Its IUPAC name is N-[2-[[[(5-chlorothiophen-2-yl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[[(5-chlorothiophen-2-yl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111363232 |
| Molecular Formula | C16H28ClIN4OS |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | N-[2-[[[(5-chlorothiophen-2-yl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)N(C)Cc1ccc(Cl)s1.I |
| InChI | InChI=1S/C16H27ClN4OS.HI/c1-6-18-15(20-10-9-19-14(22)16(2,3)4)21(5)11-12-7-8-13(17)23-12;/h7-8H,6,9-11H2,1-5H3,(H,18,20)(H,19,22);1H |
| InChIKey | HQLZHADNMPERGI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|