C14H25ClIN3S — CID 111158836
1-butyl-2-[2-(5-chlorothiophen-2-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111158836) has the molecular formula C14H25ClIN3S and a molecular weight of 429.80 g/mol. Its IUPAC name is 1-butyl-2-[2-(5-chlorothiophen-2-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-butyl-2-[2-(5-chlorothiophen-2-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111158836 |
| Molecular Formula | C14H25ClIN3S |
| Molecular Weight | 429.80 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-butyl-2-[2-(5-chlorothiophen-2-yl)ethyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N/CCc1ccc(Cl)s1)NCC.I |
| InChI | InChI=1S/C14H24ClN3S.HI/c1-4-6-11-18(3)14(16-5-2)17-10-9-12-7-8-13(15)19-12;/h7-8H,4-6,9-11H2,1-3H3,(H,16,17);1H |
| InChIKey | LVUBGFJNESQOFD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|