C13H30N4 — CID 111159221
1-butyl-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]-1-methylguanidine (PubChem CID 111159221) has the molecular formula C13H30N4 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-butyl-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]-1-methylguanidine.
| Compound Name | 1-butyl-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111159221 |
| Molecular Formula | C13H30N4 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | 1-butyl-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]-1-methylguanidine |
| SMILES | CCCCN(C)/C(=N\CCN(C)CC)NCC |
| InChI | InChI=1S/C13H30N4/c1-6-9-11-17(5)13(14-7-2)15-10-12-16(4)8-3/h6-12H2,1-5H3,(H,14,15) |
| InChIKey | FPBNZAUZUOOZMV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|