C17H36IN3O2 — CID 111160147
ethyl 7-[[[butyl(methyl)amino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide (PubChem CID 111160147) has the molecular formula C17H36IN3O2 and a molecular weight of 441.40 g/mol. Its IUPAC name is ethyl 7-[[[butyl(methyl)amino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide.
| Compound Name | ethyl 7-[[[butyl(methyl)amino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111160147 |
| Molecular Formula | C17H36IN3O2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | ethyl 7-[[[butyl(methyl)amino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide |
| SMILES | CCCCN(C)/C(=N\CCCCCCC(=O)OCC)NCC.I |
| InChI | InChI=1S/C17H35N3O2.HI/c1-5-8-15-20(4)17(18-6-2)19-14-12-10-9-11-13-16(21)22-7-3;/h5-15H2,1-4H3,(H,18,19);1H |
| InChIKey | LRXXXCXUUANCOX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|