About ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide
ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide (PubChem CID 110930117) has the molecular formula C10H22IN3O2
and a molecular weight of 343.21 g/mol. Its IUPAC name is ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide.
Molecular Properties
| Compound Name | ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide |
| PubChem CID | 110930117 |
| Molecular Formula | C10H22IN3O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide |
| SMILES | CCOC(=O)CCCCCCN=C(N)N.I |
| InChI | InChI=1S/C10H21N3O2.HI/c1-2-15-9(14)7-5-3-4-6-8-13-10(11)12;/h2-8H2,1H3,(H4,11,12,13);1H |
| InChIKey | ROYZMKJRVHQQEB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide?
The IUPAC name of ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide (CID 110930117) is ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide.
What is the SMILES notation for ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide?
The canonical SMILES for ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide is CCOC(=O)CCCCCCN=C(N)N.I.
What is the InChIKey of ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide?
The InChIKey is ROYZMKJRVHQQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2.HI/c1-2-15-9(14)7-5-3-4-6-8-13-10(11)12;/h2-8H2,1H3,(H4,11,12,13);1H.
What are the key properties of ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide?
ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide has a molecular weight of 343.21 g/mol, XLogP of 1.39, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-(diaminomethylideneamino)heptanoate;hydroiodide is sourced from PubChem (CID 110930117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).