C15H27N3O2 — CID 136921989
ethyl 7-[[ethylamino-(prop-2-ynylamino)methylidene]amino]heptanoate (PubChem CID 136921989) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is ethyl 7-[[ethylamino-(prop-2-ynylamino)methylidene]amino]heptanoate.
| Compound Name | ethyl 7-[[ethylamino-(prop-2-ynylamino)methylidene]amino]heptanoate |
|---|---|
| PubChem CID | 136921989 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | ethyl 7-[[ethylamino-(prop-2-ynylamino)methylidene]amino]heptanoate |
| SMILES | C#CCN/C(=N/CCCCCCC(=O)OCC)NCC |
| InChI | InChI=1S/C15H27N3O2/c1-4-12-17-15(16-5-2)18-13-10-8-7-9-11-14(19)20-6-3/h1H,5-13H2,2-3H3,(H2,16,17,18) |
| InChIKey | GFCFJICQKWNGSX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|