C17H33N3O2 — CID 110992531
ethyl 7-[[(cyclopentylamino)-(ethylamino)methylidene]amino]heptanoate (PubChem CID 110992531) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is ethyl 7-[[(cyclopentylamino)-(ethylamino)methylidene]amino]heptanoate.
| Compound Name | ethyl 7-[[(cyclopentylamino)-(ethylamino)methylidene]amino]heptanoate |
|---|---|
| PubChem CID | 110992531 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | ethyl 7-[[(cyclopentylamino)-(ethylamino)methylidene]amino]heptanoate |
| SMILES | CCN/C(=N\CCCCCCC(=O)OCC)NC1CCCC1 |
| InChI | InChI=1S/C17H33N3O2/c1-3-18-17(20-15-11-8-9-12-15)19-14-10-6-5-7-13-16(21)22-4-2/h15H,3-14H2,1-2H3,(H2,18,19,20) |
| InChIKey | LIHPNXNKANUSMH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|