C15H29N3O2 — CID 110958213
propan-2-yl 3-[[(cyclohexylamino)-(ethylamino)methylidene]amino]propanoate (PubChem CID 110958213) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is propan-2-yl 3-[[(cyclohexylamino)-(ethylamino)methylidene]amino]propanoate.
| Compound Name | propan-2-yl 3-[[(cyclohexylamino)-(ethylamino)methylidene]amino]propanoate |
|---|---|
| PubChem CID | 110958213 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | propan-2-yl 3-[[(cyclohexylamino)-(ethylamino)methylidene]amino]propanoate |
| SMILES | CCN/C(=N\CCC(=O)OC(C)C)NC1CCCCC1 |
| InChI | InChI=1S/C15H29N3O2/c1-4-16-15(18-13-8-6-5-7-9-13)17-11-10-14(19)20-12(2)3/h12-13H,4-11H2,1-3H3,(H2,16,17,18) |
| InChIKey | MPUHVNYGMKWXNN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|