C12H21N3O2 — CID 136922065
methyl 5-[[ethylamino-(prop-2-ynylamino)methylidene]amino]pentanoate (PubChem CID 136922065) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is methyl 5-[[ethylamino-(prop-2-ynylamino)methylidene]amino]pentanoate.
| Compound Name | methyl 5-[[ethylamino-(prop-2-ynylamino)methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 136922065 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | methyl 5-[[ethylamino-(prop-2-ynylamino)methylidene]amino]pentanoate |
| SMILES | C#CCN/C(=N/CCCCC(=O)OC)NCC |
| InChI | InChI=1S/C12H21N3O2/c1-4-9-14-12(13-5-2)15-10-7-6-8-11(16)17-3/h1H,5-10H2,2-3H3,(H2,13,14,15) |
| InChIKey | MZNLUZXUDULXNR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|