C17H35N3O2 — CID 111173701
methyl 5-[[ethylamino-(6-methylheptan-2-ylamino)methylidene]amino]pentanoate (PubChem CID 111173701) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is methyl 5-[[ethylamino-(6-methylheptan-2-ylamino)methylidene]amino]pentanoate.
| Compound Name | methyl 5-[[ethylamino-(6-methylheptan-2-ylamino)methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 111173701 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | methyl 5-[[ethylamino-(6-methylheptan-2-ylamino)methylidene]amino]pentanoate |
| SMILES | CCN/C(=N\CCCCC(=O)OC)NC(C)CCCC(C)C |
| InChI | InChI=1S/C17H35N3O2/c1-6-18-17(19-13-8-7-12-16(21)22-5)20-15(4)11-9-10-14(2)3/h14-15H,6-13H2,1-5H3,(H2,18,19,20) |
| InChIKey | DVGXUGUCZDLZOY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|