C20H43IN4O2 — CID 110999846
methyl 7-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide (PubChem CID 110999846) has the molecular formula C20H43IN4O2 and a molecular weight of 498.49 g/mol. Its IUPAC name is methyl 7-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide.
| Compound Name | methyl 7-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 110999846 |
| Molecular Formula | C20H43IN4O2 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | methyl 7-[[[5-(diethylamino)pentan-2-ylamino]-(ethylamino)methylidene]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\CCCCCCC(=O)OC)NC(C)CCCN(CC)CC.I |
| InChI | InChI=1S/C20H42N4O2.HI/c1-6-21-20(22-16-12-10-9-11-15-19(25)26-5)23-18(4)14-13-17-24(7-2)8-3;/h18H,6-17H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | WDZNABGYECSNQY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|