C21H46N6 — CID 110998255
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine (PubChem CID 110998255) has the molecular formula C21H46N6 and a molecular weight of 382.64 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 110998255 |
| Molecular Formula | C21H46N6 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.38 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[4-(4-methylpiperazin-1-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCCCN1CCN(C)CC1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C21H46N6/c1-6-22-21(24-20(4)12-11-15-26(7-2)8-3)23-13-9-10-14-27-18-16-25(5)17-19-27/h20H,6-19H2,1-5H3,(H2,22,23,24) |
| InChIKey | DEEQOFYTLBQFOO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|