C21H39N5S — CID 110997705
1-[5-(diethylamino)pentan-2-yl]-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-3-ethylguanidine (PubChem CID 110997705) has the molecular formula C21H39N5S and a molecular weight of 393.65 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-3-ethylguanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 110997705 |
| Molecular Formula | C21H39N5S |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCN1CCc2sccc2C1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C21H39N5S/c1-5-22-21(24-18(4)9-8-13-25(6-2)7-3)23-12-15-26-14-10-20-19(17-26)11-16-27-20/h11,16,18H,5-10,12-15,17H2,1-4H3,(H2,22,23,24) |
| InChIKey | AHBRDRYGZUBWBE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|