C19H27FN6O — CID 136923687
2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-3-prop-2-enylguanidine (PubChem CID 136923687) has the molecular formula C19H27FN6O and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-3-prop-2-enylguanidine.
| Compound Name | 2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136923687 |
| Molecular Formula | C19H27FN6O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\CCn1cnnc1CC)N(C)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C19H27FN6O/c1-5-9-21-19(22-10-11-26-14-23-24-18(26)6-2)25(3)13-15-7-8-17(27-4)16(20)12-15/h5,7-8,12,14H,1,6,9-11,13H2,2-4H3,(H,21,22) |
| InChIKey | WIQCWWSJCSIAPX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|