C22H36IN7 — CID 111519458
3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111519458) has the molecular formula C22H36IN7 and a molecular weight of 525.48 g/mol. Its IUPAC name is 3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111519458 |
| Molecular Formula | C22H36IN7 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)N(C)Cc1ccc(N2CCCCC2)cc1.I |
| InChI | InChI=1S/C22H35N7.HI/c1-4-21-26-25-18-29(21)16-13-24-22(23-5-2)27(3)17-19-9-11-20(12-10-19)28-14-7-6-8-15-28;/h9-12,18H,4-8,13-17H2,1-3H3,(H,23,24);1H |
| InChIKey | HPQZIMUOKMHHOZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|