C19H29F3N4 — CID 111985121
3-ethyl-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]-2-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111985121) has the molecular formula C19H29F3N4 and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]-2-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]-2-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111985121 |
| Molecular Formula | C19H29F3N4 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(4-piperidin-1-ylphenyl)methyl]-2-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)N(C)Cc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H29F3N4/c1-3-23-18(24-12-11-19(20,21)22)25(2)15-16-7-9-17(10-8-16)26-13-5-4-6-14-26/h7-10H,3-6,11-15H2,1-2H3,(H,23,24) |
| InChIKey | UHJIXFFRKANTRQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|